Name | trioctyl borate |
Synonyms | trioctylborate trioctoxyborane trioctyl borate Trioctyl borate TRI-N-OCTYL BORATE Tri-n-octyl Borate tris(1-octyl)borate Boric acid trioctyl ester BORIC ACID TRI-N-OCTYL ESTER Boric acid tri-n-octyl ester boricacid(h3bo3),trioctylester |
CAS | 2467-12-1 |
EINECS | 219-580-3 |
InChI | InChI=1/C24H51BO3/c1-4-7-10-13-16-19-22-26-25(27-23-20-17-14-11-8-5-2)28-24-21-18-15-12-9-6-3/h4-24H2,1-3H3 |
Molecular Formula | C24H51BO3 |
Molar Mass | 398.48 |
Density | 0.86 |
Boling Point | 379 °C |
Flash Point | 188 °C |
Vapor Presure | 6.57E-06mmHg at 25°C |
Storage Condition | Room Temprature |
Refractive Index | 1.4350-1.4380 |
MDL | MFCD00027324 |
RTECS | ED5630000 |
Application | Trioctyl borate is an organic borate ester, which can be regarded as a derivative of hydrogen substituted by organic groups in n-boronic acid. Trioctyl borate is often used as a polymer additive, such as an oxidation stabilizer for polyvinyl chloride. |
EPA chemical information | information provided by: ofmpub.epa.gov (external link) |